On Target GRM6_HUMAN 0.155/CHEMBL1585091
For the given ligand YJING, we have found in our database that, being scored 0.155, the most similar ligand is CHEMBL1585091. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1585091 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)CSc3ccc(NC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00004002 00803a00 000a0100 d0190611 00014060 4000c800 00002000 0000100c 00520100 010a48d0 00680004 60018000 80018800 00358200 020200c0 0a0c000c 04060400 82800004 08200500 00000000 c4100000 18068e20 20806001 8740001d 00042000 c0002040 08000000 048018d0 04008206 1006004b d0040200 01010220 |