On Target V1AR_HUMAN 0.31654677/CHEMBL1083443
For the given ligand YJING, we have found in our database that, being scored 0.31654677, the most similar ligand is CHEMBL1083443. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1083443 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(ccc1c2ccc(Cl)cc2)C(=O)N3C[C@]4(C)C[C@H]3CC(C)(C)C4 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0000a000 45001808 20100108 40010600 00001000 00000010 02000000 22003000 00000100 000008c0 00200000 40018800 82008806 00000000 01004401 20002008 00020000 02000000 06082000 90020201 00000000 18068710 10000000 0054c01c 00002000 c0000000 10040000 90000040 00004300 10060001 a0060200 01022200 |