On Target NPY2R_HUMAN 0.28082192/CHEMBL564159
For the given ligand YJING, we have found in our database that, being scored 0.28082192, the most similar ligand is CHEMBL564159. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL564159 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cccc(c1)C(=O)N2CCN(CC2)c3ccc(NC(=O)C(C)(C)C)cc3Cl |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0000c002 44003808 20100128 05010600 20001000 00000000 0a000000 0a001008 00000000 00010a40 00280004 40009800 02008806 00102001 01024441 20000008 00040000 12000000 08080000 00024200 40100000 38068700 20002020 0245801e 00002000 c0000400 00000000 80000080 08008300 00060001 80040000 00020200 |