On Target AA2BR_HUMAN 0.28708133/CHEMBL382234
For the given ligand YJING, we have found in our database that, being scored 0.28708133, the most similar ligand is CHEMBL382234. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL382234 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(ccc1OCC(=O)NCc2ccc(Cl)cc2)c3cc4N(C)C(=O)N(C)C(=O)c4[nH]3 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0400a02a 40800808 20100108 12a50602 000c10e0 0000e040 02048002 02081000 16440100 d00018e0 0d24000c 6001c800 0280d876 00e01000 013e14c1 020c800c 18820040 8280a004 04680000 00623202 c0000080 38068770 b3800041 00700008 00042000 c0000000 20068048 80040051 00004304 00460c09 400c1a00 000202a0 |