On Target NPSR1_HUMAN 0.2937853/CHEMBL1801358
For the given ligand YJING, we have found in our database that, being scored 0.2937853, the most similar ligand is CHEMBL1801358. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1801358 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc2c(c1)C(CC3CCOCC3)(c4ccc(Cl)cc4)n5ccnc25 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0000c102 47800208 2010010a 10010700 a0081060 40002000 02040400 01081000 80000900 100818c4 08108008 40018800 03001866 21a00000 018200a1 020d100c 00800000 0e002000 00482000 00420201 80100120 38008110 21005040 81528011 00002400 e0000001 00060000 50014080 06000286 0046080a 400c0800 00020400 |