On Target NK2R_HUMAN 0.5851064/CHEMBL4111499
For the given ligand YJING, we have found in our database that, being scored 0.5851064, the most similar ligand is CHEMBL4111499. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL4111499 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CCOc1cc(C=O)ccc1OCc2ccc(Cl)cc2 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008000 40000808 20000109 00210200 00001000 00004000 02040000 00000000 00000100 00000840 00000000 40008800 0280c086 00010080 01004001 22088008 00000000 02000000 00480000 00020200 00000000 08020320 00000000 00c01004 00002000 80002000 00060000 00000000 00000200 00020008 c0000000 00020000 |