On Target MC4R_HUMAN 0.58878505/CHEMBL1501300
For the given ligand YJING, we have found in our database that, being scored 0.58878505, the most similar ligand is CHEMBL1501300. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1501300 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc(CNCCc2ccc(Cl)cc2)cc1OCc3ccccc3 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008000 44000008 20100108 00210600 00001000 00004000 02040000 02001000 00000180 00080840 08200000 40008800 02804826 00010080 01000401 02088008 00000000 02000000 00480000 00020200 00000000 18208120 00000000 81c49010 00002000 c0002000 00260000 80000000 04000300 0006000a 60040000 00020600 |