On Target CCR1_HUMAN 0.37984496/CHEMBL143690
For the given ligand YJING, we have found in our database that, being scored 0.37984496, the most similar ligand is CHEMBL143690. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL143690 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(cc(OC)c1OC)C(CCCN2CCC(O)(CC2)c3ccc(Cl)cc3)C#N |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00008001 43000208 2010010a 00010600 00001000 40004000 42040000 20000000 00100900 000808c0 08300000 50018800 020040a6 20200000 01000001 000c800c 00400000 02000004 00880000 00020a01 00000100 38000120 01800480 00500010 00002001 80000000 00160000 10000000 00000200 0006000a 44000000 00022680 |