On Target TAAR1_HUMAN 0.4574468/CHEMBL294703
For the given ligand YJING, we have found in our database that, being scored 0.4574468, the most similar ligand is CHEMBL294703. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL294703 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | NC(=N)c1cccc(COc2ccccc2)c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04000000 00000008 20000108 00010600 00001001 00004000 02000400 00001000 00000100 00000843 40000000 40008000 00800802 00010000 01000001 02080008 00000000 02000000 00000000 40020000 00000000 08008020 01000000 00c01000 00000000 80002000 48000000 00000000 00000208 00060000 40040004 00000000 |