On Target MC3R_HUMAN 0.26744187/CHEMBL257759
For the given ligand YJING, we have found in our database that, being scored 0.26744187, the most similar ligand is CHEMBL257759. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL257759 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CC[C@H](NC(=O)C)c1cc(Cl)ccc1C2CCN(CC2)C(=O)[C@@H]3CN(C[C@H]3c4ccc(OC)cc4F)C(C)(C)C |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00028008 0d801608 20100108 12010600 00001600 00000012 06040000 22041001 00200880 000889e8 08300000 50039800 0e0088a6 00201000 81000481 02040008 01000200 02008000 00000018 00020201 80020104 18248700 00004000 81540018 00003800 c0000001 00164000 90000001 04000300 0086801b 00040010 00822600 |