On Target DRD2_HUMAN 0.37190083/CHEMBL255163
For the given ligand YJING, we have found in our database that, being scored 0.37190083, the most similar ligand is CHEMBL255163. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL255163 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | FCCOc1cccc(CN2CCN(CC2)c3ccc(Cl)cc3)c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0400c002 44000008 20100128 04010600 00001000 00000000 02000000 03001000 00000000 00010a40 00200004 40008800 02800806 00002080 01000441 00080008 00040000 02000000 08080400 00020200 40100000 28008100 20000020 02448002 00002000 c0000000 00080000 90000080 08008300 00060000 00040000 02020600 |