On Target HRH3_HUMAN 0.47368422/CHEMBL231146
For the given ligand YJING, we have found in our database that, being scored 0.47368422, the most similar ligand is CHEMBL231146. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL231146 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CN(C)CCCOc1ccc(OCc2ccccc2Cl)c(CN(C)C)c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008000 44000008 20100108 00010600 00001000 02004100 02000000 02001400 00000100 00000840 08200000 40008800 02800806 00010080 01000001 02082008 00201000 02008000 00880000 00020200 00001040 18008120 01000080 00c49010 00006000 80002202 00080000 80000000 00000300 00060000 44040000 02020240 |