On Target NK1R_HUMAN 0.38181818/CHEMBL93909
For the given ligand YJING, we have found in our database that, being scored 0.38181818, the most similar ligand is CHEMBL93909. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL93909 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(C)cc(COC[C@@H](N)c2ccccc2)c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00000000 48000008 20000108 80010600 00001051 00004000 02000000 00001040 00000100 00080848 08001000 40008000 00000802 00010000 01041005 02080008 08000000 02000000 04080000 40020200 00010020 08008020 03000000 00400010 00000400 80002000 00080000 00000000 00000200 00060002 40040004 02000400 |