On Target GRM7_HUMAN 0.25/CHEMBL3560922
For the given ligand YJING, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL3560922. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3560922 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)COc3ccc(OC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0400100a 00801a08 20080108 d0090610 00005060 0200c000 02002000 00001044 00500100 000838d0 00040004 4001c000 80808802 00218200 010b00c1 0a0c200c 18020000 82800004 04200500 00020000 c4000000 18068a20 31804000 8140001c 00042000 c0002040 08080008 00001804 04000204 1006084a c0040200 12000020 |