On Target NPY4R_HUMAN 0.27102804/CHEMBL3559801
For the given ligand YJING, we have found in our database that, being scored 0.27102804, the most similar ligand is CHEMBL3559801. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3559801 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CC(C)(C)c1ccc(OC2CCCCC2O)cc1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04000000 01000008 20000108 00010300 00081000 02000000 02040000 00000000 00000000 00080840 08000000 40008000 00800002 00800000 11200001 00082008 00800000 02000000 02402000 00020001 00000000 08000000 05000000 08400010 00000000 80000000 00120000 00800000 00000200 00020002 00000000 00000400 |