On Target ADA2B_HUMAN 0.3478261/CHEMBL2432051
For the given ligand YJING, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL2432051. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2432051 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(CN[C@H]2C3C4CC5C6C4CC3C6C25)cc(OC)c1OC |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00000001 45000008 20100108 00010600 00001000 00000000 42040000 22001000 00000000 000008c0 00200000 40018000 00004802 00000010 01000401 00008008 00000000 02000004 02082000 00020a01 00000000 18008010 00000000 00548010 00000000 c0000000 00220000 90001000 00000300 01060008 20060000 00000200 |