On Target DRD3_HUMAN 0.36842105/CHEMBL3799593
For the given ligand YJING, we have found in our database that, being scored 0.36842105, the most similar ligand is CHEMBL3799593. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3799593 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccccc1OCCNC[C@@H](O)c2ccc(O)c(O)c2 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04002000 4a000008 20100108 00210602 00001080 80004000 02000000 00000000 00000180 00080840 08200000 40008000 00804002 00000000 01281001 02088008 10000000 02000000 00000000 00020200 00000000 18240020 12000000 81400010 00000000 80000000 00520000 00000001 04000200 0006000a 40000000 00000680 |