On Target ADRB1_HUMAN 0.36065573/CHEMBL38569
For the given ligand YJING, we have found in our database that, being scored 0.36065573, the most similar ligand is CHEMBL38569. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL38569 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | C[C@H](Cc1ccc(OCC(=O)N)cc1)NC[C@H](O)c2cccc(Cl)c2 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008000 14000008 20100108 00010602 00001080 00004000 06040000 00000000 00000980 00080840 08340000 4000c800 02808006 00000000 81081001 00080008 10000000 82000000 00000000 00020201 00000100 18240720 02000000 81480010 00002000 80000000 00120008 00000000 04000200 00060002 40000000 00022600 |