On Target 5HT1E_HUMAN 0.2631579/CHEMBL2391541
For the given ligand YJING, we have found in our database that, being scored 0.2631579, the most similar ligand is CHEMBL2391541. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2391541 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc2[nH]cc(CCN(CC=C)CC=C)c2c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00000002 00000808 20100108 41010610 00041000 00000000 060c2000 00000400 00400080 00090840 08200004 40008000 10000806 00410000 01000041 0004000c 00000000 02000100 00200400 00020200 40000000 18208008 20800000 91400010 00042000 80000000 081a0000 00000020 04000200 00060002 04040200 02000620 |