On Target ADA2C_HUMAN 0.44715446/CHEMBL3735289
For the given ligand YJING, we have found in our database that, being scored 0.44715446, the most similar ligand is CHEMBL3735289. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3735289 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | Cl.Cl.CNCc1cc(OCc2ccc3ccc(N)nc3c2)ccc1Cl |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008002 44000808 20004108 00010600 00041004 0000c000 02000000 02001000 00400100 00000840 00200004 40008800 82800806 00410080 01000041 020c000c 00000001 02000400 00280000 00220200 40000800 0c008128 20800800 80e49000 00002000 80002200 001000c0 80000000 00000308 00060000 48040000 00020220 |