On Target AGTR2_HUMAN 0.38235295/CHEMBL156165
For the given ligand YJING, we have found in our database that, being scored 0.38235295, the most similar ligand is CHEMBL156165. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL156165 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc2CN(C(Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(c4ccc(Cl)cc4)c5ccc(Cl)cc5 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008008 46805008 20100108 10210600 000010a0 c0004000 07041000 03001204 00000980 00080840 08300000 4000b8c0 0780c8a6 20210080 c1080481 0208a008 90000200 02008020 00480008 00020201 80020100 18208f20 03004040 81c49418 00006800 e0002001 00264000 c0000000 04000380 0087000b 60046000 00022600 |