On Target DRD5_HUMAN 0.3467742/CHEMBL1940404
For the given ligand YJING, we have found in our database that, being scored 0.3467742, the most similar ligand is CHEMBL1940404. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1940404 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | OC1(CCN(CCCOc2ccc(F)cc2)CC1)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008000 01000208 20100108 02010600 00001000 02004010 02000000 20000000 00000900 000808c0 08300000 50018800 028000a6 00001000 01000001 000c2008 00200000 02000000 00800000 00420201 00000100 18000120 01001080 00500010 00002001 80000000 00040000 10000001 00000200 0006800a 40000000 00022640 |