On Target NPY1R_HUMAN 0.30201343/CHEMBL2397291
For the given ligand YJING, we have found in our database that, being scored 0.30201343, the most similar ligand is CHEMBL2397291. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2397291 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CCOc1cccc(c1)C2(C3CC(C)CC23)N4CCN(CC4)c5ncccn5 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04000002 47000008 2010010a 04010600 00001000 40004000 02002000 22001000 00000900 200908c0 08300004 40018000 00800802 21202080 01000401 001c000c 00000000 02004000 02482000 00a20201 00000100 3e008010 20800861 02548010 00000000 c0000000 00000000 90000000 0800031a 01460802 40061000 00000680 |