On Target AA3R_HUMAN 0.30872482/CHEMBL3601563
For the given ligand YJING, we have found in our database that, being scored 0.30872482, the most similar ligand is CHEMBL3601563. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3601563 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc2c(nccc2c1OC)[C@H]3CCc4ccc(Cl)cc34 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0000800a 05000008 2000410a 10010600 00041020 00080000 070c0410 01001001 00000800 000808cc 08108004 40808800 02004826 00601000 81020041 0206808c 00000000 06000001 00300008 00020201 40000100 18008108 20804000 80440010 00002000 a0000000 00160040 40000080 02000284 0082000a 00040000 20030400 |