On Target 5HT2C_HUMAN 0.45945945/CHEMBL3260334
For the given ligand YJING, we have found in our database that, being scored 0.45945945, the most similar ligand is CHEMBL3260334. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3260334 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | Clc1cccc(COc2ccc(Br)cc2OC3CNC3)c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0400e000 10008008 20000108 00210602 00001080 00004002 06000000 00000001 00000100 00000840 00200002 40008800 02804016 00010000 81001001 02088008 00000000 02000000 00400000 00020040 00000000 18040120 12008000 00c01010 00002000 80002000 00420000 00000000 00800200 00060008 40000008 08020280 |