On Target VIPR1_HUMAN 0.22099447/CHEMBL1784685
For the given ligand YJING, we have found in our database that, being scored 0.22099447, the most similar ligand is CHEMBL1784685. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL1784685 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc(cc1)c2ccn(c3ccc(C(=O)O)c(O)c3)c2c4ccc(cc4C)C(=O)N |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00006002 80000a09 20000108 d0090610 20001021 04026008 22240000 00081800 00100100 100008c0 10008084 60018008 81008812 00208200 21020041 880c200c 00020000 82802004 04200100 10620402 40100040 18028e20 30801000 8140000c 00040001 c0080040 08020200 00000850 0400c204 10060648 c0040a00 00000020 |