On Target 5HT4R_HUMAN 0.33333334/CHEMBL550302
For the given ligand YJING, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL550302. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL550302 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc2[nH]cc(CNN3CCOCC3)c2c1 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00000006 08000808 2008210c 80010610 00041180 00000000 064c4000 00001000 00000000 00000848 01200004 40008000 00000806 00400000 21021041 000c010c 10000008 02000000 04200000 00020000 40000000 08009008 72800000 80400000 00046410 80000000 18220000 00000000 00000200 004e0000 00050200 800402a0 |