On Target CCR2_HUMAN 0.33566433/CHEMBL340450
For the given ligand YJING, we have found in our database that, being scored 0.33566433, the most similar ligand is CHEMBL340450. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL340450 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1ccc2c(c1)cc(C(=O)O)n2Cc3ccc(Cl)c(Cl)c3 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00008002 08001a08 20100108 10010600 00041020 0000c000 06080000 00001004 80500300 000008c0 00080004 40018800 02008846 00500000 81020041 020c000c 00008000 02800004 00280000 00020200 40000000 18068b78 20802002 8140000c 00002000 c0100000 00040000 00000000 04400204 00060049 c0040200 00020000 |