On Target MC5R_HUMAN 0.26900584/CHEMBL3932950
For the given ligand YJING, we have found in our database that, being scored 0.26900584, the most similar ligand is CHEMBL3932950. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3932950 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | NC(=N)NCCC[C@H]1N[C@@H](CNC(=O)c2ccc3ccccc3c2)CCN(CC(Oc4ccccc4)c5ccccc5)C1=O |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04012000 01007c08 20100108 04010e02 00001080 00004000 02000000 2200300c 00200380 000909e2 08200000 4003b000 06809812 00012001 81181401 02180008 10000000 02000000 00000000 00020201 08000000 382f8628 12000003 83d0101c 00000000 c0002000 40800000 90000001 0c000310 00060013 e00c4000 00002600 |