On Target EDNRA_HUMAN 0.41517857/CHEMBL96614
For the given ligand Xanax, we have found in our database that, being scored 0.41517857, the most similar ligand is CHEMBL96614. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL96614 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@]2(NCc3nnc(C)n3c4ccccc24)c5ccccc5)n1 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000001a 00000818 40140d00 10050f00 810000c0 00184186 02802000 0b007441 00010b00 00180840 093d0124 6400d800 0c008882 00100300 20461640 001c218c 18008000 82000027 04c00018 00260201 40020141 1801aa00 37e000c0 0840011c 00001811 e1000440 00000000 c0021001 01000384 00c61803 d4040080 e43406a0 |