On Target V1AR_HUMAN 0.39534885/CHEMBL1837037
For the given ligand Xanax, we have found in our database that, being scored 0.39534885, the most similar ligand is CHEMBL1837037. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1837037 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1Cc2cc(Cl)ccc2n3c(C1)nnc3C4CCN(CC4)c5ccccn5 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c002 09000408 40145900 10010f10 21040040 00102086 04800020 2a103601 00000900 201408c8 01218124 56018840 02000807 00000200 80060440 000c210c 08048000 06004226 08600008 00a60241 60120401 1c41a100 25800800 00700510 00002010 c0080640 00080080 90031180 0000810c 00068800 84041080 e0360200 |