On Target 5HT1D_HUMAN 0.30113637/CHEMBL272781
For the given ligand Xanax, we have found in our database that, being scored 0.30113637, the most similar ligand is CHEMBL272781. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL272781 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CC1NC(=Nc2c(Cl)ccc(Cl)c12)N |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008042 0c000000 00000100 00010e80 00000000 00100000 0c000000 02003000 00000000 0008885a 19200004 44008820 02001804 40000009 800200c0 00100018 04000800 02000004 01000000 00000000 40000c00 08018100 22000010 00400010 00282008 88000600 60000000 90000a00 00000110 00860082 08040020 e0020700 |