On Target NPSR1_HUMAN 0.25510204/CHEMBL1801319
For the given ligand Xanax, we have found in our database that, being scored 0.25510204, the most similar ligand is CHEMBL1801319. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1801319 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Clc1ccc(cc1)C2(Cc3ccccc3)c4ccccc4c5nccn25 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c102 00800200 10100100 10010600 20080060 00002000 00000400 01081000 80100900 100818c0 08108008 40018800 03001864 00a00000 00820080 020d0004 00000000 0e002000 00480000 00400001 80100100 38108100 21405040 81400011 00002000 e0000001 00040000 50014080 06000084 0046080a 400c0800 00020500 |