On Target CCR5_HUMAN 0.2835821/CHEMBL3219780
For the given ligand Xanax, we have found in our database that, being scored 0.2835821, the most similar ligand is CHEMBL3219780. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3219780 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CC(C)c1nnc(C)n1C2CC3CCC(C2)N3CC[C@H](NC(=O)C4CCC(F)(F)CC4)c5ccc(N)cc5 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00010002 01801e08 40100100 c0010600 01080c00 00000014 04800000 22001200 00200900 100c09e0 08308104 52019800 0400880e 01800000 00020440 000c200c 00108000 02000000 02402000 00240201 c0000100 1848a610 21000000 00500418 00000000 c0000200 00000024 90011000 00000104 0206001b a0060080 20002600 |