On Target NK2R_HUMAN 0.3/CHEMBL52330
For the given ligand Xanax, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL52330. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL52330 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | FC(F)(F)c1cc(CO[C@H]2OCCN(CC3=NNC(=O)N3)[C@H]2c4ccccc4)cc(c1)C(F)(F)F |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00000018 000c0008 40100100 80010e00 090000d1 00104004 00801c00 0a003441 04200900 00180870 0c211020 44008802 00008802 01010000 00261408 0228210c 18008040 02000002 04400000 40200000 00010020 08008030 33000000 00400010 10000400 c0002400 00080000 b4020001 00008306 00060002 c4540084 02002600 |