On Target MC4R_HUMAN 0.36548224/CHEMBL1891068
For the given ligand Xanax, we have found in our database that, being scored 0.36548224, the most similar ligand is CHEMBL1891068. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1891068 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Cc1ccccc1CN2Cc3cnnn3c4ccccc4C2C#N |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000000a 44000018 60440102 18010f10 00000020 00104084 00805000 0a207c01 00000100 10180840 09210004 40808800 00000886 00200208 00030640 000c210c 00422800 02000002 80400000 00060000 40020021 18018820 21801440 81440110 00202400 c0000640 00004000 80032000 0400010c 00060102 44040000 e4100782 |