On Target CCR1_HUMAN 0.3188406/CHEMBL142925
For the given ligand Xanax, we have found in our database that, being scored 0.3188406, the most similar ligand is CHEMBL142925. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL142925 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1C(=O)c2ccccc2C(CCCN3CCC(O)(CC3)c4ccc(Cl)cc4)(C#N)c5ccccc15 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c00a 01000a00 00100102 10010600 00000020 0008c040 01000440 23001000 00100900 000808c0 08390024 5001c800 020088a6 00308000 00020060 000c008c 00448000 02000001 08800008 00000201 40520100 38028760 21816480 00540014 00002001 a0000001 00040010 d0001080 0208818c 0086000b c00600a0 20032680 |