On Target TAAR1_HUMAN 0.3178808/CHEMBL3190696
For the given ligand Xanax, we have found in our database that, being scored 0.3178808, the most similar ligand is CHEMBL3190696. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3190696 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Oc1ccc(Cl)cc1\C=N\CCc2ccccc2 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008000 00040008 20200100 08010600 40402000 00000000 16000000 00000000 00000100 00080841 08000000 40008800 02000006 0000a000 80040000 20082008 02000800 02000002 00000000 00020000 00000000 38000100 00000000 81400012 00002000 80000000 40100000 00000000 0c200008 00060402 40000800 00020400 |