On Target HRH3_HUMAN 0.31736526/CHEMBL3238444
For the given ligand Xanax, we have found in our database that, being scored 0.31736526, the most similar ligand is CHEMBL3238444. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3238444 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Cc1nnc(C)n1c2ccc(OCCCN3CCCCC3)cc2 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 04000002 01000008 60100108 00010600 01001040 02000004 02800000 20001008 00000100 000008c0 00200104 50018800 00800802 00000200 01060041 000c200c 08208000 00000004 00c00000 00260201 40000000 1800a000 21000080 00100010 00000001 40000040 00040000 10001000 00000204 00060000 80040080 01202240 |