On Target NK1R_HUMAN 0.3888889/CHEMBL357303
For the given ligand Xanax, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL357303. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL357303 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN(Cc1n[nH]c(O)n1)[C@H](COCc2cc(Cl)cc(Cl)c2)c3ccccc3 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008010 10000018 40400100 80010e00 210000d0 00104024 04800000 0a083441 00000900 00180840 08211020 44008800 02000886 00010400 80061408 0208200c 18008000 02000802 04400000 00200000 00070020 08008120 33000000 00400010 00002400 c0002480 00080000 80020001 00800304 00060002 c4040080 0a020602 |