On Target OPRK_HUMAN 0.37674418/CHEMBL127619
For the given ligand Xanax, we have found in our database that, being scored 0.37674418, the most similar ligand is CHEMBL127619. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL127619 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1C(CCNC(=O)c2cc3ccccc3[nH]2)CN=C(c4ccccc4)c5cc(Cl)ccc15 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c002 04049c00 00300120 1c010e00 60040022 00180040 14000000 23203001 00200300 00090fe5 08290004 40028c00 02008806 0050a000 80060440 021c0106 02248800 02000007 08200000 00000201 60102000 380f8708 20802000 8240001e 00102080 e0000000 40080000 d5001080 0808819c 00068413 e0040280 22024600 |