On Target CNR1_HUMAN 0.35185185/CHEMBL274983
For the given ligand Xanax, we have found in our database that, being scored 0.35185185, the most similar ligand is CHEMBL274983. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL274983 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CC(NC(=O)c1nc(c2ccc(Cl)cc2Cl)n(n1)c3ccc(Cl)cc3)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c006 00800808 c0180100 00010e00 01000040 0010c026 00c08000 0a0a3441 00400904 c0180843 0839002c 44008808 02008866 00200601 00060440 001c200c 08008000 02002622 88400000 00200000 c0100000 0800a720 21804000 0041401c 00202010 c0000640 100c8010 80021020 00000115 01661003 c4060a80 02028782 |