On Target PTAFR_HUMAN 0.65789473/CHEMBL20344
For the given ligand Xanax, we have found in our database that, being scored 0.65789473, the most similar ligand is CHEMBL20344. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL20344 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Cc1nnc2CN=C(c3ccccc3Cl)c4cc(ccc4n12)C#CCOc5cccnc5 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0580820a 00064819 62204d0a 98090680 41447041 04880006 10880000 01201401 00000120 00280841 09010124 4404ce00 82800884 08008208 01060040 000d248c 08108800 12820005 00600000 00260000 40020400 2881e100 61800001 02408110 00802414 e00407c0 40008340 40021081 0200029c 00860802 c4140084 a4260400 |