On Target 5HT1F_HUMAN 0.26168224/CHEMBL126340
For the given ligand Xanax, we have found in our database that, being scored 0.26168224, the most similar ligand is CHEMBL126340. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL126340 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN(C)CCc1cccc2c1cc(C(=O)c3ccccc3)n2S(=O)(=O)c4ccccc4 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000001a 00804800 21102100 50b10640 000e0020 00080000 40000000 01001400 02000100 20080860 0828a004 60808800 90009802 00d48009 84220041 02040084 00000000 02004105 00600000 00822000 c0000000 18268208 a0882050 8940001c 00802000 a0000020 20000040 40000008 04414084 208e0823 80041200 20010620 |