On Target NPBW1_HUMAN 0.25630254/CHEMBL1979187
For the given ligand Xanax, we have found in our database that, being scored 0.25630254, the most similar ligand is CHEMBL1979187. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1979187 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | [O-][N+](=O)c1ccccc1C(C#N)C2=C(Cl)C=NN(Cc3cccc4ccccc34)C2=O |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00010006 52002618 20200180 00010618 00080047 00188000 0004a840 01001000 16100000 802808e0 0c00200c 7001a800 060198aa 08e00000 20160140 000d201c 08410008 82004001 00200010 00220000 40020400 1c018518 21810c81 83720014 04107000 e0000600 00528000 50040080 04080088 0006000a 24244000 248214a1 |