On Target CLTR1_HUMAN 0.28140703/CHEMBL11905
For the given ligand Xanax, we have found in our database that, being scored 0.28140703, the most similar ligand is CHEMBL11905. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL11905 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | OC(=O)c1cc(Cl)cc(C(=O)\C=C\c2cccc(\C=C\c3ccc4ccccc4n3)c2)c1O |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008002 14000808 20004300 10010e02 00040021 00824000 86800081 08000e08 01840100 00b80a40 28000104 40008800 02008826 00400000 80020042 0a0c200c 00000400 02100000 00218000 40020800 40000000 18028b28 20808000 80418014 01002000 82000001 00502040 40000200 00404004 00260802 c4040000 00020400 |