On Target GRM3_HUMAN 0.2850877/CHEMBL3885379
For the given ligand Xanax, we have found in our database that, being scored 0.2850877, the most similar ligand is CHEMBL3885379. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3885379 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | FC(F)(F)c1c(OC[C@H]2C[C@@H]2c3ccc(Cl)cc3)ccn4c(CC5CC5)nnc14 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0400800a 41000008 6010418a 18011710 010c5020 02004006 03804c00 00200a08 00000900 010c0850 08108004 42848840 020008a6 03a00000 11020840 020c200c 00a08060 2680800c 00600008 40260041 50000520 0c008120 25800842 00620010 00042406 80000200 08040000 90010880 00400304 00864002 c0100080 22660600 |