On Target NPY5R_HUMAN 0.35602096/CHEMBL494018
For the given ligand Xanax, we have found in our database that, being scored 0.35602096, the most similar ligand is CHEMBL494018. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL494018 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Fc1ccc(cc1)C2(CNC(=N2)c3ccccn3)c4ccc(F)cc4 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00000002 00040010 00304100 1a010e20 40040020 00100014 10200000 13203001 00000380 00090843 18230014 40008400 00000802 00009008 00060400 023c0104 00008800 02000182 00200000 00100200 40220001 38238000 60800000 83400810 00100088 e0100000 40000040 c0000001 0e00019c 00068002 60040080 04104600 |