On Target AA2AR_HUMAN 0.33152175/CHEMBL170215
For the given ligand Xanax, we have found in our database that, being scored 0.33152175, the most similar ligand is CHEMBL170215. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL170215 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Clc1ccc(Cc2n[nH]c(n2)c3cnccn3)cc1Cl |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00018202 04010008 40000100 10010610 21000040 00080004 04808000 04001200 10000500 000c0848 88008000 42008810 06000024 00000003 80820000 000c200c 08008000 16002001 00400008 10200000 00080000 4840a100 21000000 00548010 00042002 80100200 38040008 10011024 0000000c 00223802 82000080 30020402 |