On Target DRD4_HUMAN 0.30337077/CHEMBL303519
For the given ligand Xanax, we have found in our database that, being scored 0.30337077, the most similar ligand is CHEMBL303519. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL303519 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | C(N1CCN(CC1)c2ncccn2)c3cccc4c3Cc5ccccc45 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000200a 00000001 00000100 94010600 00000001 04004000 10002400 03001000 04000100 20090840 08200004 40008000 00000882 00202000 20000400 001c208c 00020000 02005000 04400000 00a00000 00020000 2e008000 30804870 02400010 00800000 e0000000 08004000 c0000041 0a004198 00460802 40041000 00000680 |